ChemNet > CAS > 10354-00-4 dibenzosuberenol
10354-00-4 dibenzosuberenol
| product Name |
dibenzosuberenol |
| CAS No |
10354-00-4 |
| Synonyms |
dibenzo(b,f)cyclohepten-1-ol; 5H-Dibenzo[a,d]cyclohepten-5-ol; Dibenzo[b,f]cyclohepten-1-ol; 5H-dibenzo[a,d][7]annulen-5-ol |
| Molecular Formula |
C15H12O |
| Molecular Weight |
208.2552 |
| InChI |
InChI=1/C15H12O/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-10,15-16H |
| EINECS |
233-774-5 |
| Molecular Structure |
|
| Density |
1.196g/cm3 |
| Melting point |
122.5-124℃ |
| Boiling point |
401.9°C at 760 mmHg |
| Refractive index |
1.659 |
| Flash point |
147.6°C |
| Vapour Pressur |
3.52E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
